C21H22N4O3 — CID 22098946
(E)-3-[4-[[3-(4,5-dihydro-1H-imidazol-2-ylamino)benzoyl]amino]-3,5-dimethylphenyl]prop-2-enoic acid (PubChem CID 22098946) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is (E)-3-[4-[[3-(4,5-dihydro-1H-imidazol-2-ylamino)benzoyl]amino]-3,5-dimethylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[3-(4,5-dihydro-1H-imidazol-2-ylamino)benzoyl]amino]-3,5-dimethylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22098946 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (E)-3-[4-[[3-(4,5-dihydro-1H-imidazol-2-ylamino)benzoyl]amino]-3,5-dimethylphenyl]prop-2-enoic acid |
| SMILES | Cc1cc(/C=C/C(=O)O)cc(C)c1NC(=O)c1cccc(NC2=NCCN2)c1 |
| InChI | InChI=1S/C21H22N4O3/c1-13-10-15(6-7-18(26)27)11-14(2)19(13)25-20(28)16-4-3-5-17(12-16)24-21-22-8-9-23-21/h3-7,10-12H,8-9H2,1-2H3,(H,25,28)(H,26,27)(H2,22,23,24)/b7-6+ |
| InChIKey | NGLDQEAARWHFFU-VOTSOKGWSA-N |
| XLogP | 3.02 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|