C17H18N4O — CID 173309503
N-phenyl-3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzamide (PubChem CID 173309503) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is N-phenyl-3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzamide.
| Compound Name | N-phenyl-3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzamide |
|---|---|
| PubChem CID | 173309503 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N-phenyl-3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzamide |
| SMILES | O=C(Nc1ccccc1)c1cccc(NC2=NCCCN2)c1 |
| InChI | InChI=1S/C17H18N4O/c22-16(20-14-7-2-1-3-8-14)13-6-4-9-15(12-13)21-17-18-10-5-11-19-17/h1-4,6-9,12H,5,10-11H2,(H,20,22)(H2,18,19,21) |
| InChIKey | HDVHIDRTIIGEQS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |