C22H23BrClN5O4 — CID 174434893
3-bromo-2-(3-chlorophenyl)-3-[[2-[[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzoyl]amino]acetyl]amino]propanoic acid (PubChem CID 174434893) has the molecular formula C22H23BrClN5O4 and a molecular weight of 536.81 g/mol. Its IUPAC name is 3-bromo-2-(3-chlorophenyl)-3-[[2-[[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzoyl]amino]acetyl]amino]propanoic acid.
| Compound Name | 3-bromo-2-(3-chlorophenyl)-3-[[2-[[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzoyl]amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 174434893 |
| Molecular Formula | C22H23BrClN5O4 |
| Molecular Weight | 536.81 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | 3-bromo-2-(3-chlorophenyl)-3-[[2-[[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzoyl]amino]acetyl]amino]propanoic acid |
| SMILES | O=C(CNC(=O)c1cccc(NC2=NCCCN2)c1)NC(Br)C(C(=O)O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H23BrClN5O4/c23-19(18(21(32)33)13-4-1-6-15(24)10-13)29-17(30)12-27-20(31)14-5-2-7-16(11-14)28-22-25-8-3-9-26-22/h1-2,4-7,10-11,18-19H,3,8-9,12H2,(H,27,31)(H,29,30)(H,32,33)(H2,25,26,28) |
| InChIKey | BFZPZUXTNUECOJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 131.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.81 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|