3-(1,4,5,6-tetrahydropyrimidine-2-carbonylamino)benzoic acid

C12H13N3O3 — CID 91902040

IUPAC3-(1,4,5,6-tetrahydropyrimidine-2-carbonylamino)benzoic acid
SMILESO=C(Nc1cccc(C(=O)O)c1)C1=NCCCN1
InChIInChI=1S/C12H13N3O3/c16-11(10-13-5-2-6-14-10)15-9-4-1-3-8(7-9)12(17)18/h1,3-4,7H,2,5-6H2,(H,13,14)(H,15,16)(H,17,18)
InChIKeyXQQKHHJAJGYKNA-UHFFFAOYSA-N
MW247.25 g/mol
LogP0.72
Rot. Bonds3

About 3-(1,4,5,6-tetrahydropyrimidine-2-carbonylamino)benzoic acid

3-(1,4,5,6-tetrahydropyrimidine-2-carbonylamino)benzoic acid (PubChem CID 91902040) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 3-(1,4,5,6-tetrahydropyrimidine-2-carbonylamino)benzoic acid.

Molecular Properties

Compound Name3-(1,4,5,6-tetrahydropyrimidine-2-carbonylamino)benzoic acid
PubChem CID91902040
Molecular FormulaC12H13N3O3
Molecular Weight247.25 g/mol
Exact Mass247.10
IUPAC Name3-(1,4,5,6-tetrahydropyrimidine-2-carbonylamino)benzoic acid
SMILESO=C(Nc1cccc(C(=O)O)c1)C1=NCCCN1
InChIInChI=1S/C12H13N3O3/c16-11(10-13-5-2-6-14-10)15-9-4-1-3-8(7-9)12(17)18/h1,3-4,7H,2,5-6H2,(H,13,14)(H,15,16)(H,17,18)
InChIKeyXQQKHHJAJGYKNA-UHFFFAOYSA-N
XLogP0.72
TPSA90.79 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.25
LogP ≤ 50.72
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 3-(1,4,5,6-tetrahydropyrimidine-2-carbonylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,4,5,6-tetrahydropyrimidine-2-carbonylamino)benzoic acid?
The IUPAC name of 3-(1,4,5,6-tetrahydropyrimidine-2-carbonylamino)benzoic acid (CID 91902040) is 3-(1,4,5,6-tetrahydropyrimidine-2-carbonylamino)benzoic acid.
What is the SMILES notation for 3-(1,4,5,6-tetrahydropyrimidine-2-carbonylamino)benzoic acid?
The canonical SMILES for 3-(1,4,5,6-tetrahydropyrimidine-2-carbonylamino)benzoic acid is O=C(Nc1cccc(C(=O)O)c1)C1=NCCCN1.
What is the InChIKey of 3-(1,4,5,6-tetrahydropyrimidine-2-carbonylamino)benzoic acid?
The InChIKey is XQQKHHJAJGYKNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O3/c16-11(10-13-5-2-6-14-10)15-9-4-1-3-8(7-9)12(17)18/h1,3-4,7H,2,5-6H2,(H,13,14)(H,15,16)(H,17,18).
What are the key properties of 3-(1,4,5,6-tetrahydropyrimidine-2-carbonylamino)benzoic acid?
3-(1,4,5,6-tetrahydropyrimidine-2-carbonylamino)benzoic acid has a molecular weight of 247.25 g/mol, XLogP of 0.72, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,4,5,6-tetrahydropyrimidine-2-carbonylamino)benzoic acid is sourced from PubChem (CID 91902040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).