C14H13N3O — CID 91901954
N-naphthalen-2-yl-4,5-dihydro-1H-imidazole-2-carboxamide (PubChem CID 91901954) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is N-naphthalen-2-yl-4,5-dihydro-1H-imidazole-2-carboxamide.
| Compound Name | N-naphthalen-2-yl-4,5-dihydro-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 91901954 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-naphthalen-2-yl-4,5-dihydro-1H-imidazole-2-carboxamide |
| SMILES | O=C(Nc1ccc2ccccc2c1)C1=NCCN1 |
| InChI | InChI=1S/C14H13N3O/c18-14(13-15-7-8-16-13)17-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9H,7-8H2,(H,15,16)(H,17,18) |
| InChIKey | SHXCMVJTWAOJAZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |