C18H13N3O — CID 141390644
N-naphthalen-2-yl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide (PubChem CID 141390644) has the molecular formula C18H13N3O and a molecular weight of 287.32 g/mol. Its IUPAC name is N-naphthalen-2-yl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide.
| Compound Name | N-naphthalen-2-yl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 141390644 |
| Molecular Formula | C18H13N3O |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-naphthalen-2-yl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc2ccccc2c1)c1cc2cccnc2[nH]1 |
| InChI | InChI=1S/C18H13N3O/c22-18(16-11-14-6-3-9-19-17(14)21-16)20-15-8-7-12-4-1-2-5-13(12)10-15/h1-11H,(H,19,21)(H,20,22) |
| InChIKey | IUPNYEUXEOPPDR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |