About molecular hydrogen;1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid
molecular hydrogen;1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (PubChem CID 156715490) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is molecular hydrogen;1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid.
Analyze molecular hydrogen;1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid?
The IUPAC name of molecular hydrogen;1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CID 156715490) is molecular hydrogen;1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid.
What is the SMILES notation for molecular hydrogen;1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid?
The canonical SMILES for molecular hydrogen;1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is O=C(O)c1cc2cccnc2[nH]1.[H][H].
What is the InChIKey of molecular hydrogen;1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid?
The InChIKey is ZXESJDYOHMQXBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2.H2/c11-8(12)6-4-5-2-1-3-9-7(5)10-6;/h1-4H,(H,9,10)(H,11,12);1H.
What are the key properties of molecular hydrogen;1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid?
molecular hydrogen;1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid has a molecular weight of 164.16 g/mol, XLogP of 1.51, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is sourced from PubChem (CID 156715490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).