C13H9N3O2 — CID 82376068
4-pyridin-2-yl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (PubChem CID 82376068) has the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. Its IUPAC name is 4-pyridin-2-yl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid.
| Compound Name | 4-pyridin-2-yl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 82376068 |
| Molecular Formula | C13H9N3O2 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 4-pyridin-2-yl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(-c3ccccn3)ccnc2[nH]1 |
| InChI | InChI=1S/C13H9N3O2/c17-13(18)11-7-9-8(4-6-15-12(9)16-11)10-3-1-2-5-14-10/h1-7H,(H,15,16)(H,17,18) |
| InChIKey | FRULHXIZJMIAOR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |