C10H11N3O2 — CID 91901916
N-(2-hydroxyphenyl)-4,5-dihydro-1H-imidazole-2-carboxamide (PubChem CID 91901916) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-4,5-dihydro-1H-imidazole-2-carboxamide.
| Compound Name | N-(2-hydroxyphenyl)-4,5-dihydro-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 91901916 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | N-(2-hydroxyphenyl)-4,5-dihydro-1H-imidazole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1O)C1=NCCN1 |
| InChI | InChI=1S/C10H11N3O2/c14-8-4-2-1-3-7(8)13-10(15)9-11-5-6-12-9/h1-4,14H,5-6H2,(H,11,12)(H,13,15) |
| InChIKey | TYTWIBNHLPNIAZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|