C12H15N3O2 — CID 91902034
N-(4-hydroxy-2-methylphenyl)-1,4,5,6-tetrahydropyrimidine-2-carboxamide (PubChem CID 91902034) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylphenyl)-1,4,5,6-tetrahydropyrimidine-2-carboxamide.
| Compound Name | N-(4-hydroxy-2-methylphenyl)-1,4,5,6-tetrahydropyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 91902034 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-(4-hydroxy-2-methylphenyl)-1,4,5,6-tetrahydropyrimidine-2-carboxamide |
| SMILES | Cc1cc(O)ccc1NC(=O)C1=NCCCN1 |
| InChI | InChI=1S/C12H15N3O2/c1-8-7-9(16)3-4-10(8)15-12(17)11-13-5-2-6-14-11/h3-4,7,16H,2,5-6H2,1H3,(H,13,14)(H,15,17) |
| InChIKey | JAXXDVLBRYRZAN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|