C12H14IN3O — CID 91902340
N-(4-iodophenyl)-4,5,6,7-tetrahydro-1H-1,3-diazepine-2-carboxamide (PubChem CID 91902340) has the molecular formula C12H14IN3O and a molecular weight of 343.17 g/mol. Its IUPAC name is N-(4-iodophenyl)-4,5,6,7-tetrahydro-1H-1,3-diazepine-2-carboxamide.
| Compound Name | N-(4-iodophenyl)-4,5,6,7-tetrahydro-1H-1,3-diazepine-2-carboxamide |
|---|---|
| PubChem CID | 91902340 |
| Molecular Formula | C12H14IN3O |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | N-(4-iodophenyl)-4,5,6,7-tetrahydro-1H-1,3-diazepine-2-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1)C1=NCCCCN1 |
| InChI | InChI=1S/C12H14IN3O/c13-9-3-5-10(6-4-9)16-12(17)11-14-7-1-2-8-15-11/h3-6H,1-2,7-8H2,(H,14,15)(H,16,17) |
| InChIKey | ZFLYMAURDWOGQD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|