C15H21N3O — CID 91902026
N-(4-butylphenyl)-1,4,5,6-tetrahydropyrimidine-2-carboxamide (PubChem CID 91902026) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is N-(4-butylphenyl)-1,4,5,6-tetrahydropyrimidine-2-carboxamide.
| Compound Name | N-(4-butylphenyl)-1,4,5,6-tetrahydropyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 91902026 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-(4-butylphenyl)-1,4,5,6-tetrahydropyrimidine-2-carboxamide |
| SMILES | CCCCc1ccc(NC(=O)C2=NCCCN2)cc1 |
| InChI | InChI=1S/C15H21N3O/c1-2-3-5-12-6-8-13(9-7-12)18-15(19)14-16-10-4-11-17-14/h6-9H,2-5,10-11H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | PVVFMEXQXWKJQJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |