C12H12Cl3N3O — CID 91902345
N-(2,4,5-trichlorophenyl)-4,5,6,7-tetrahydro-1H-1,3-diazepine-2-carboxamide (PubChem CID 91902345) has the molecular formula C12H12Cl3N3O and a molecular weight of 320.61 g/mol. Its IUPAC name is N-(2,4,5-trichlorophenyl)-4,5,6,7-tetrahydro-1H-1,3-diazepine-2-carboxamide.
| Compound Name | N-(2,4,5-trichlorophenyl)-4,5,6,7-tetrahydro-1H-1,3-diazepine-2-carboxamide |
|---|---|
| PubChem CID | 91902345 |
| Molecular Formula | C12H12Cl3N3O |
| Molecular Weight | 320.61 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | N-(2,4,5-trichlorophenyl)-4,5,6,7-tetrahydro-1H-1,3-diazepine-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)C1=NCCCCN1 |
| InChI | InChI=1S/C12H12Cl3N3O/c13-7-5-9(15)10(6-8(7)14)18-12(19)11-16-3-1-2-4-17-11/h5-6H,1-4H2,(H,16,17)(H,18,19) |
| InChIKey | IIFCZCBIYHFYNW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.61 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|