C11H6Cl3N3O2 — CID 103603355
6-oxo-N-(2,4,5-trichlorophenyl)-1H-pyridazine-3-carboxamide (PubChem CID 103603355) has the molecular formula C11H6Cl3N3O2 and a molecular weight of 318.55 g/mol. Its IUPAC name is 6-oxo-N-(2,4,5-trichlorophenyl)-1H-pyridazine-3-carboxamide.
| Compound Name | 6-oxo-N-(2,4,5-trichlorophenyl)-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 103603355 |
| Molecular Formula | C11H6Cl3N3O2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | 6-oxo-N-(2,4,5-trichlorophenyl)-1H-pyridazine-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C11H6Cl3N3O2/c12-5-3-7(14)9(4-6(5)13)15-11(19)8-1-2-10(18)17-16-8/h1-4H,(H,15,19)(H,17,18) |
| InChIKey | GJPGUCQVMAOHHW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|