C11H9FN4O2 — CID 114040790
N-(3-amino-5-fluorophenyl)-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 114040790) has the molecular formula C11H9FN4O2 and a molecular weight of 248.22 g/mol. Its IUPAC name is N-(3-amino-5-fluorophenyl)-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-(3-amino-5-fluorophenyl)-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 114040790 |
| Molecular Formula | C11H9FN4O2 |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | N-(3-amino-5-fluorophenyl)-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | Nc1cc(F)cc(NC(=O)c2ccc(=O)[nH]n2)c1 |
| InChI | InChI=1S/C11H9FN4O2/c12-6-3-7(13)5-8(4-6)14-11(18)9-1-2-10(17)16-15-9/h1-5H,13H2,(H,14,18)(H,16,17) |
| InChIKey | TYODWWQQJCZLGB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|