C12H10FN3O2 — CID 103600396
N-(5-fluoro-2-methylphenyl)-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 103600396) has the molecular formula C12H10FN3O2 and a molecular weight of 247.23 g/mol. Its IUPAC name is N-(5-fluoro-2-methylphenyl)-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-(5-fluoro-2-methylphenyl)-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 103600396 |
| Molecular Formula | C12H10FN3O2 |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | N-(5-fluoro-2-methylphenyl)-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | Cc1ccc(F)cc1NC(=O)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C12H10FN3O2/c1-7-2-3-8(13)6-10(7)14-12(18)9-4-5-11(17)16-15-9/h2-6H,1H3,(H,14,18)(H,16,17) |
| InChIKey | XWGAZKHAXGGRHQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |