C18H15N3O2 — CID 112790938
N-(2-benzylphenyl)-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 112790938) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is N-(2-benzylphenyl)-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-(2-benzylphenyl)-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 112790938 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-(2-benzylphenyl)-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Cc1ccccc1)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C18H15N3O2/c22-17-11-10-16(20-21-17)18(23)19-15-9-5-4-8-14(15)12-13-6-2-1-3-7-13/h1-11H,12H2,(H,19,23)(H,21,22) |
| InChIKey | IDGHQXJDYAKLOV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |