C21H26N4O2 — CID 173318243
N-[3-[4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)butoxy]phenyl]benzamide (PubChem CID 173318243) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[3-[4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)butoxy]phenyl]benzamide.
| Compound Name | N-[3-[4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)butoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 173318243 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N-[3-[4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)butoxy]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(OCCCCNC2=NCCCN2)c1)c1ccccc1 |
| InChI | InChI=1S/C21H26N4O2/c26-20(17-8-2-1-3-9-17)25-18-10-6-11-19(16-18)27-15-5-4-12-22-21-23-13-7-14-24-21/h1-3,6,8-11,16H,4-5,7,12-15H2,(H,25,26)(H2,22,23,24) |
| InChIKey | KGQFNMVGOYBBKQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|