C21H20N2O2 — CID 17133255
N-[3-(3-phenylpropoxy)phenyl]pyridine-4-carboxamide (PubChem CID 17133255) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is N-[3-(3-phenylpropoxy)phenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-(3-phenylpropoxy)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 17133255 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-[3-(3-phenylpropoxy)phenyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1cccc(OCCCc2ccccc2)c1)c1ccncc1 |
| InChI | InChI=1S/C21H20N2O2/c24-21(18-11-13-22-14-12-18)23-19-9-4-10-20(16-19)25-15-5-8-17-6-2-1-3-7-17/h1-4,6-7,9-14,16H,5,8,15H2,(H,23,24) |
| InChIKey | SLUMCWBIPAQYAW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|