C14H21IN4O2 — CID 119115387
N-[3-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethoxy]phenyl]acetamide;hydroiodide (PubChem CID 119115387) has the molecular formula C14H21IN4O2 and a molecular weight of 404.25 g/mol. Its IUPAC name is N-[3-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethoxy]phenyl]acetamide;hydroiodide.
| Compound Name | N-[3-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethoxy]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 119115387 |
| Molecular Formula | C14H21IN4O2 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | N-[3-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethoxy]phenyl]acetamide;hydroiodide |
| SMILES | CC(=O)Nc1cccc(OCCNC2=NCCCN2)c1.I |
| InChI | InChI=1S/C14H20N4O2.HI/c1-11(19)18-12-4-2-5-13(10-12)20-9-8-17-14-15-6-3-7-16-14;/h2,4-5,10H,3,6-9H2,1H3,(H,18,19)(H2,15,16,17);1H |
| InChIKey | BZLGHULFTGSPEC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|