C13H20ClN3O3 — CID 119319260
N-[2-(3-acetamidophenoxy)ethyl]-3-aminopropanamide;hydrochloride (PubChem CID 119319260) has the molecular formula C13H20ClN3O3 and a molecular weight of 301.77 g/mol. Its IUPAC name is N-[2-(3-acetamidophenoxy)ethyl]-3-aminopropanamide;hydrochloride.
| Compound Name | N-[2-(3-acetamidophenoxy)ethyl]-3-aminopropanamide;hydrochloride |
|---|---|
| PubChem CID | 119319260 |
| Molecular Formula | C13H20ClN3O3 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-[2-(3-acetamidophenoxy)ethyl]-3-aminopropanamide;hydrochloride |
| SMILES | CC(=O)Nc1cccc(OCCNC(=O)CCN)c1.Cl |
| InChI | InChI=1S/C13H19N3O3.ClH/c1-10(17)16-11-3-2-4-12(9-11)19-8-7-15-13(18)5-6-14;/h2-4,9H,5-8,14H2,1H3,(H,15,18)(H,16,17);1H |
| InChIKey | XTJKOSJJLZEPGT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|