C11H16ClFN2O2 — CID 119287036
3-amino-N-[2-(4-fluorophenoxy)ethyl]propanamide;hydrochloride (PubChem CID 119287036) has the molecular formula C11H16ClFN2O2 and a molecular weight of 262.71 g/mol. Its IUPAC name is 3-amino-N-[2-(4-fluorophenoxy)ethyl]propanamide;hydrochloride.
| Compound Name | 3-amino-N-[2-(4-fluorophenoxy)ethyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119287036 |
| Molecular Formula | C11H16ClFN2O2 |
| Molecular Weight | 262.71 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 3-amino-N-[2-(4-fluorophenoxy)ethyl]propanamide;hydrochloride |
| SMILES | Cl.NCCC(=O)NCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C11H15FN2O2.ClH/c12-9-1-3-10(4-2-9)16-8-7-14-11(15)5-6-13;/h1-4H,5-8,13H2,(H,14,15);1H |
| InChIKey | VTYKXAOXVYHAOG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.71 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|