C25H22N2OS — CID 7954448
(E)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]-3-(4-phenylphenyl)prop-2-en-1-one (PubChem CID 7954448) has the molecular formula C25H22N2OS and a molecular weight of 398.53 g/mol. Its IUPAC name is (E)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]-3-(4-phenylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]-3-(4-phenylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7954448 |
| Molecular Formula | C25H22N2OS |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (E)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]-3-(4-phenylphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2)cc1)c1ccc(NC2=NCCCS2)cc1 |
| InChI | InChI=1S/C25H22N2OS/c28-24(22-12-14-23(15-13-22)27-25-26-17-4-18-29-25)16-9-19-7-10-21(11-8-19)20-5-2-1-3-6-20/h1-3,5-16H,4,17-18H2,(H,26,27)/b16-9+ |
| InChIKey | FLDFXHVGPKZBCU-CXUHLZMHSA-N |
| XLogP | 6.15 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|