C23H26N2OS — CID 3645010
3-(4-tert-butylphenyl)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]prop-2-en-1-one (PubChem CID 3645010) has the molecular formula C23H26N2OS and a molecular weight of 378.54 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]prop-2-en-1-one.
| Compound Name | 3-(4-tert-butylphenyl)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 3645010 |
| Molecular Formula | C23H26N2OS |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 3-(4-tert-butylphenyl)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]prop-2-en-1-one |
| SMILES | CC(C)(C)c1ccc(C=CC(=O)c2ccc(NC3=NCCCS3)cc2)cc1 |
| InChI | InChI=1S/C23H26N2OS/c1-23(2,3)19-10-5-17(6-11-19)7-14-21(26)18-8-12-20(13-9-18)25-22-24-15-4-16-27-22/h5-14H,4,15-16H2,1-3H3,(H,24,25) |
| InChIKey | NPOWANFXRLTQMC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|