C12H16N2S — CID 28878465
N-(3-ethylphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 28878465) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is N-(3-ethylphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
| Compound Name | N-(3-ethylphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 28878465 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N-(3-ethylphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | CCc1cccc(NC2=NCCCS2)c1 |
| InChI | InChI=1S/C12H16N2S/c1-2-10-5-3-6-11(9-10)14-12-13-7-4-8-15-12/h3,5-6,9H,2,4,7-8H2,1H3,(H,13,14) |
| InChIKey | RAFHAUVZAMABEE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |