C10H9N3S — CID 29068246
3-(4,5-dihydro-1,3-thiazol-2-ylamino)benzonitrile (PubChem CID 29068246) has the molecular formula C10H9N3S and a molecular weight of 203.27 g/mol. Its IUPAC name is 3-(4,5-dihydro-1,3-thiazol-2-ylamino)benzonitrile.
| Compound Name | 3-(4,5-dihydro-1,3-thiazol-2-ylamino)benzonitrile |
|---|---|
| PubChem CID | 29068246 |
| Molecular Formula | C10H9N3S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 3-(4,5-dihydro-1,3-thiazol-2-ylamino)benzonitrile |
| SMILES | N#Cc1cccc(NC2=NCCS2)c1 |
| InChI | InChI=1S/C10H9N3S/c11-7-8-2-1-3-9(6-8)13-10-12-4-5-14-10/h1-3,6H,4-5H2,(H,12,13) |
| InChIKey | RMYRZRUHGBXNPC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |