C11H9N3OS — CID 2635778
3-cyano-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide (PubChem CID 2635778) has the molecular formula C11H9N3OS and a molecular weight of 231.28 g/mol. Its IUPAC name is 3-cyano-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-cyano-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 2635778 |
| Molecular Formula | C11H9N3OS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 3-cyano-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide |
| SMILES | N#Cc1cccc(C(=O)NC2=NCCS2)c1 |
| InChI | InChI=1S/C11H9N3OS/c12-7-8-2-1-3-9(6-8)10(15)14-11-13-4-5-16-11/h1-3,6H,4-5H2,(H,13,14,15) |
| InChIKey | WQUYVLGWCFDYKQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |