C14H6F4N2O — CID 103600288
3-cyano-N-(2,3,5,6-tetrafluorophenyl)benzamide (PubChem CID 103600288) has the molecular formula C14H6F4N2O and a molecular weight of 294.21 g/mol. Its IUPAC name is 3-cyano-N-(2,3,5,6-tetrafluorophenyl)benzamide.
| Compound Name | 3-cyano-N-(2,3,5,6-tetrafluorophenyl)benzamide |
|---|---|
| PubChem CID | 103600288 |
| Molecular Formula | C14H6F4N2O |
| Molecular Weight | 294.21 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 3-cyano-N-(2,3,5,6-tetrafluorophenyl)benzamide |
| SMILES | N#Cc1cccc(C(=O)Nc2c(F)c(F)cc(F)c2F)c1 |
| InChI | InChI=1S/C14H6F4N2O/c15-9-5-10(16)12(18)13(11(9)17)20-14(21)8-3-1-2-7(4-8)6-19/h1-5H,(H,20,21) |
| InChIKey | WOTJIVLGFHEWRS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.21 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|