C14H8Cl2N2O — CID 43386585
3-cyano-N-(2,6-dichlorophenyl)benzamide (PubChem CID 43386585) has the molecular formula C14H8Cl2N2O and a molecular weight of 291.14 g/mol. Its IUPAC name is 3-cyano-N-(2,6-dichlorophenyl)benzamide.
| Compound Name | 3-cyano-N-(2,6-dichlorophenyl)benzamide |
|---|---|
| PubChem CID | 43386585 |
| Molecular Formula | C14H8Cl2N2O |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 3-cyano-N-(2,6-dichlorophenyl)benzamide |
| SMILES | N#Cc1cccc(C(=O)Nc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C14H8Cl2N2O/c15-11-5-2-6-12(16)13(11)18-14(19)10-4-1-3-9(7-10)8-17/h1-7H,(H,18,19) |
| InChIKey | IABFHBCMGGRPOT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |