C14H13Cl2NO2 — CID 51058525
N-(2,6-dichlorophenyl)-3-methylbenzamide;hydrate (PubChem CID 51058525) has the molecular formula C14H13Cl2NO2 and a molecular weight of 298.17 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-3-methylbenzamide;hydrate.
| Compound Name | N-(2,6-dichlorophenyl)-3-methylbenzamide;hydrate |
|---|---|
| PubChem CID | 51058525 |
| Molecular Formula | C14H13Cl2NO2 |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | N-(2,6-dichlorophenyl)-3-methylbenzamide;hydrate |
| SMILES | Cc1cccc(C(=O)Nc2c(Cl)cccc2Cl)c1.O |
| InChI | InChI=1S/C14H11Cl2NO.H2O/c1-9-4-2-5-10(8-9)14(18)17-13-11(15)6-3-7-12(13)16;/h2-8H,1H3,(H,17,18);1H2 |
| InChIKey | NKOLFPNHFCFPLB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |