C18H18Cl2N2O2 — CID 109055921
1-N-(2,6-dichlorophenyl)-3-N,3-N-diethylbenzene-1,3-dicarboxamide (PubChem CID 109055921) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is 1-N-(2,6-dichlorophenyl)-3-N,3-N-diethylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-(2,6-dichlorophenyl)-3-N,3-N-diethylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109055921 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 1-N-(2,6-dichlorophenyl)-3-N,3-N-diethylbenzene-1,3-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1cccc(C(=O)Nc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c1-3-22(4-2)18(24)13-8-5-7-12(11-13)17(23)21-16-14(19)9-6-10-15(16)20/h5-11H,3-4H2,1-2H3,(H,21,23) |
| InChIKey | VPLNLFOZKOKDRE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |