C18H17F3N2O2 — CID 109055931
3-N,3-N-diethyl-1-N-(2,3,4-trifluorophenyl)benzene-1,3-dicarboxamide (PubChem CID 109055931) has the molecular formula C18H17F3N2O2 and a molecular weight of 350.34 g/mol. Its IUPAC name is 3-N,3-N-diethyl-1-N-(2,3,4-trifluorophenyl)benzene-1,3-dicarboxamide.
| Compound Name | 3-N,3-N-diethyl-1-N-(2,3,4-trifluorophenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109055931 |
| Molecular Formula | C18H17F3N2O2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 3-N,3-N-diethyl-1-N-(2,3,4-trifluorophenyl)benzene-1,3-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1cccc(C(=O)Nc2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C18H17F3N2O2/c1-3-23(4-2)18(25)12-7-5-6-11(10-12)17(24)22-14-9-8-13(19)15(20)16(14)21/h5-10H,3-4H2,1-2H3,(H,22,24) |
| InChIKey | MXFPWRNTPSXZQY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|