C14H14N4O2S2 — CID 4066059
1-N,4-N-bis(4,5-dihydro-1,3-thiazol-2-yl)benzene-1,4-dicarboxamide (PubChem CID 4066059) has the molecular formula C14H14N4O2S2 and a molecular weight of 334.43 g/mol. Its IUPAC name is 1-N,4-N-bis(4,5-dihydro-1,3-thiazol-2-yl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(4,5-dihydro-1,3-thiazol-2-yl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 4066059 |
| Molecular Formula | C14H14N4O2S2 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 1-N,4-N-bis(4,5-dihydro-1,3-thiazol-2-yl)benzene-1,4-dicarboxamide |
| SMILES | O=C(NC1=NCCS1)c1ccc(C(=O)NC2=NCCS2)cc1 |
| InChI | InChI=1S/C14H14N4O2S2/c19-11(17-13-15-5-7-21-13)9-1-2-10(4-3-9)12(20)18-14-16-6-8-22-14/h1-4H,5-8H2,(H,15,17,19)(H,16,18,20) |
| InChIKey | GAPPQMHUNOGSJE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |