C8H7IN2OS2 — CID 122157651
N-(4,5-dihydro-1,3-thiazol-2-yl)-5-iodothiophene-3-carboxamide (PubChem CID 122157651) has the molecular formula C8H7IN2OS2 and a molecular weight of 338.20 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-5-iodothiophene-3-carboxamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 122157651 |
| Molecular Formula | C8H7IN2OS2 |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.90 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-5-iodothiophene-3-carboxamide |
| SMILES | O=C(NC1=NCCS1)c1csc(I)c1 |
| InChI | InChI=1S/C8H7IN2OS2/c9-6-3-5(4-14-6)7(12)11-8-10-1-2-13-8/h3-4H,1-2H2,(H,10,11,12) |
| InChIKey | FJYBLORSJJEYGT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|