C12H9IN2O3S — CID 79685249
N-(6-amino-1,3-benzodioxol-5-yl)-5-iodothiophene-3-carboxamide (PubChem CID 79685249) has the molecular formula C12H9IN2O3S and a molecular weight of 388.19 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-5-iodothiophene-3-carboxamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 79685249 |
| Molecular Formula | C12H9IN2O3S |
| Molecular Weight | 388.19 g/mol |
| Exact Mass | 387.94 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-5-iodothiophene-3-carboxamide |
| SMILES | Nc1cc2c(cc1NC(=O)c1csc(I)c1)OCO2 |
| InChI | InChI=1S/C12H9IN2O3S/c13-11-1-6(4-19-11)12(16)15-8-3-10-9(2-7(8)14)17-5-18-10/h1-4H,5,14H2,(H,15,16) |
| InChIKey | KRXVDVMKMDMTSB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|