C18H19ClN2O3S2 — CID 119618244
N-(6-amino-1,3-benzodioxol-5-yl)-4-(1,3-dithian-2-yl)benzamide;hydrochloride (PubChem CID 119618244) has the molecular formula C18H19ClN2O3S2 and a molecular weight of 410.95 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-4-(1,3-dithian-2-yl)benzamide;hydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-4-(1,3-dithian-2-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119618244 |
| Molecular Formula | C18H19ClN2O3S2 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-4-(1,3-dithian-2-yl)benzamide;hydrochloride |
| SMILES | Cl.Nc1cc2c(cc1NC(=O)c1ccc(C3SCCCS3)cc1)OCO2 |
| InChI | InChI=1S/C18H18N2O3S2.ClH/c19-13-8-15-16(23-10-22-15)9-14(13)20-17(21)11-2-4-12(5-3-11)18-24-6-1-7-25-18;/h2-5,8-9,18H,1,6-7,10,19H2,(H,20,21);1H |
| InChIKey | JDJGLNVBVIUMIX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|