C18H23ClN2O3 — CID 119618672
N-(6-amino-1,3-benzodioxol-5-yl)adamantane-2-carboxamide;hydrochloride (PubChem CID 119618672) has the molecular formula C18H23ClN2O3 and a molecular weight of 350.85 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)adamantane-2-carboxamide;hydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)adamantane-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119618672 |
| Molecular Formula | C18H23ClN2O3 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)adamantane-2-carboxamide;hydrochloride |
| SMILES | Cl.Nc1cc2c(cc1NC(=O)C1C3CC4CC(C3)CC1C4)OCO2 |
| InChI | InChI=1S/C18H22N2O3.ClH/c19-13-6-15-16(23-8-22-15)7-14(13)20-18(21)17-11-2-9-1-10(4-11)5-12(17)3-9;/h6-7,9-12,17H,1-5,8,19H2,(H,20,21);1H |
| InChIKey | OHJANVZUFPXTMU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|