C12H15ClN2O5 — CID 119261098
N-(6-amino-1,3-benzodioxol-5-yl)-1,4-dioxane-2-carboxamide;hydrochloride (PubChem CID 119261098) has the molecular formula C12H15ClN2O5 and a molecular weight of 302.71 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-1,4-dioxane-2-carboxamide;hydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-1,4-dioxane-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119261098 |
| Molecular Formula | C12H15ClN2O5 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-1,4-dioxane-2-carboxamide;hydrochloride |
| SMILES | Cl.Nc1cc2c(cc1NC(=O)C1COCCO1)OCO2 |
| InChI | InChI=1S/C12H14N2O5.ClH/c13-7-3-9-10(19-6-18-9)4-8(7)14-12(15)11-5-16-1-2-17-11;/h3-4,11H,1-2,5-6,13H2,(H,14,15);1H |
| InChIKey | QBZMBLCRKNVBSW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|