C12H15BrN2O3 — CID 116813578
N-(2-amino-6-bromo-4-methylphenyl)-1,4-dioxane-2-carboxamide (PubChem CID 116813578) has the molecular formula C12H15BrN2O3 and a molecular weight of 315.17 g/mol. Its IUPAC name is N-(2-amino-6-bromo-4-methylphenyl)-1,4-dioxane-2-carboxamide.
| Compound Name | N-(2-amino-6-bromo-4-methylphenyl)-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 116813578 |
| Molecular Formula | C12H15BrN2O3 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | N-(2-amino-6-bromo-4-methylphenyl)-1,4-dioxane-2-carboxamide |
| SMILES | Cc1cc(N)c(NC(=O)C2COCCO2)c(Br)c1 |
| InChI | InChI=1S/C12H15BrN2O3/c1-7-4-8(13)11(9(14)5-7)15-12(16)10-6-17-2-3-18-10/h4-5,10H,2-3,6,14H2,1H3,(H,15,16) |
| InChIKey | ALGBLTBPMVCSDX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|