C12H16N2O4 — CID 63258036
N-(2-amino-5-methoxyphenyl)-1,4-dioxane-2-carboxamide (PubChem CID 63258036) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is N-(2-amino-5-methoxyphenyl)-1,4-dioxane-2-carboxamide.
| Compound Name | N-(2-amino-5-methoxyphenyl)-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 63258036 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-(2-amino-5-methoxyphenyl)-1,4-dioxane-2-carboxamide |
| SMILES | COc1ccc(N)c(NC(=O)C2COCCO2)c1 |
| InChI | InChI=1S/C12H16N2O4/c1-16-8-2-3-9(13)10(6-8)14-12(15)11-7-17-4-5-18-11/h2-3,6,11H,4-5,7,13H2,1H3,(H,14,15) |
| InChIKey | BICSJHHELYEPDJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|