C11H14N2O4 — CID 47178164
N-(6-methoxy-3-pyridinyl)-1,4-dioxane-2-carboxamide (PubChem CID 47178164) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is N-(6-methoxy-3-pyridinyl)-1,4-dioxane-2-carboxamide.
| Compound Name | N-(6-methoxy-3-pyridinyl)-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 47178164 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | N-(6-methoxy-3-pyridinyl)-1,4-dioxane-2-carboxamide |
| SMILES | COc1ccc(NC(=O)C2COCCO2)cn1 |
| InChI | InChI=1S/C11H14N2O4/c1-15-10-3-2-8(6-12-10)13-11(14)9-7-16-4-5-17-9/h2-3,6,9H,4-5,7H2,1H3,(H,13,14) |
| InChIKey | RZVTUTSBUWYNNW-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |