C11H15N3O5 — CID 47291922
methyl 2-[4-(1,4-dioxane-2-carbonylamino)pyrazol-1-yl]acetate (PubChem CID 47291922) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is methyl 2-[4-(1,4-dioxane-2-carbonylamino)pyrazol-1-yl]acetate.
| Compound Name | methyl 2-[4-(1,4-dioxane-2-carbonylamino)pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 47291922 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | methyl 2-[4-(1,4-dioxane-2-carbonylamino)pyrazol-1-yl]acetate |
| SMILES | COC(=O)Cn1cc(NC(=O)C2COCCO2)cn1 |
| InChI | InChI=1S/C11H15N3O5/c1-17-10(15)6-14-5-8(4-12-14)13-11(16)9-7-18-2-3-19-9/h4-5,9H,2-3,6-7H2,1H3,(H,13,16) |
| InChIKey | UOOVHTJWEYBBET-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |