C10H15N3O3S — CID 54904175
methyl 2-[4-(3-methylsulfanylpropanoylamino)pyrazol-1-yl]acetate (PubChem CID 54904175) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is methyl 2-[4-(3-methylsulfanylpropanoylamino)pyrazol-1-yl]acetate.
| Compound Name | methyl 2-[4-(3-methylsulfanylpropanoylamino)pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 54904175 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | methyl 2-[4-(3-methylsulfanylpropanoylamino)pyrazol-1-yl]acetate |
| SMILES | COC(=O)Cn1cc(NC(=O)CCSC)cn1 |
| InChI | InChI=1S/C10H15N3O3S/c1-16-10(15)7-13-6-8(5-11-13)12-9(14)3-4-17-2/h5-6H,3-4,7H2,1-2H3,(H,12,14) |
| InChIKey | FLMAIZDZDUMXPS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |