C13H13N3O5 — CID 103956596
methyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate (PubChem CID 103956596) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is methyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate.
| Compound Name | methyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 103956596 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | methyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate |
| SMILES | COC(=O)Cn1cc(NC(=O)c2ccc(O)c(O)c2)cn1 |
| InChI | InChI=1S/C13H13N3O5/c1-21-12(19)7-16-6-9(5-14-16)15-13(20)8-2-3-10(17)11(18)4-8/h2-6,17-18H,7H2,1H3,(H,15,20) |
| InChIKey | LJWQXENGVJYOKR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|