methyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate

C13H13N3O5 — CID 103956596

IUPACmethyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate
SMILESCOC(=O)Cn1cc(NC(=O)c2ccc(O)c(O)c2)cn1
InChIInChI=1S/C13H13N3O5/c1-21-12(19)7-16-6-9(5-14-16)15-13(20)8-2-3-10(17)11(18)4-8/h2-6,17-18H,7H2,1H3,(H,15,20)
InChIKeyLJWQXENGVJYOKR-UHFFFAOYSA-N
MW291.26 g/mol
LogP0.72
Rot. Bonds4

About methyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate

methyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate (PubChem CID 103956596) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is methyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate
PubChem CID103956596
Molecular FormulaC13H13N3O5
Molecular Weight291.26 g/mol
Exact Mass291.09
IUPAC Namemethyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate
SMILESCOC(=O)Cn1cc(NC(=O)c2ccc(O)c(O)c2)cn1
InChIInChI=1S/C13H13N3O5/c1-21-12(19)7-16-6-9(5-14-16)15-13(20)8-2-3-10(17)11(18)4-8/h2-6,17-18H,7H2,1H3,(H,15,20)
InChIKeyLJWQXENGVJYOKR-UHFFFAOYSA-N
XLogP0.72
TPSA113.68 Ų
H-Bond Donors3
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.26
LogP ≤ 50.72
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}

Analyze methyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate?
The IUPAC name of methyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate (CID 103956596) is methyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate.
What is the SMILES notation for methyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate?
The canonical SMILES for methyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate is COC(=O)Cn1cc(NC(=O)c2ccc(O)c(O)c2)cn1.
What is the InChIKey of methyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate?
The InChIKey is LJWQXENGVJYOKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O5/c1-21-12(19)7-16-6-9(5-14-16)15-13(20)8-2-3-10(17)11(18)4-8/h2-6,17-18H,7H2,1H3,(H,15,20).
What are the key properties of methyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate?
methyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate has a molecular weight of 291.26 g/mol, XLogP of 0.72, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-[(3,4-dihydroxybenzoyl)amino]pyrazol-1-yl]acetate is sourced from PubChem (CID 103956596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).