C12H13ClN4O3 — CID 61018368
methyl 2-[4-[(4-chloro-1-methylpyrrole-2-carbonyl)amino]pyrazol-1-yl]acetate (PubChem CID 61018368) has the molecular formula C12H13ClN4O3 and a molecular weight of 296.71 g/mol. Its IUPAC name is methyl 2-[4-[(4-chloro-1-methylpyrrole-2-carbonyl)amino]pyrazol-1-yl]acetate.
| Compound Name | methyl 2-[4-[(4-chloro-1-methylpyrrole-2-carbonyl)amino]pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 61018368 |
| Molecular Formula | C12H13ClN4O3 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | methyl 2-[4-[(4-chloro-1-methylpyrrole-2-carbonyl)amino]pyrazol-1-yl]acetate |
| SMILES | COC(=O)Cn1cc(NC(=O)c2cc(Cl)cn2C)cn1 |
| InChI | InChI=1S/C12H13ClN4O3/c1-16-5-8(13)3-10(16)12(19)15-9-4-14-17(6-9)7-11(18)20-2/h3-6H,7H2,1-2H3,(H,15,19) |
| InChIKey | DSISTGHLKJAJPS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |