C12H12N4O4 — CID 61017369
methyl 2-[4-[(3-hydroxypyridine-2-carbonyl)amino]pyrazol-1-yl]acetate (PubChem CID 61017369) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is methyl 2-[4-[(3-hydroxypyridine-2-carbonyl)amino]pyrazol-1-yl]acetate.
| Compound Name | methyl 2-[4-[(3-hydroxypyridine-2-carbonyl)amino]pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 61017369 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | methyl 2-[4-[(3-hydroxypyridine-2-carbonyl)amino]pyrazol-1-yl]acetate |
| SMILES | COC(=O)Cn1cc(NC(=O)c2ncccc2O)cn1 |
| InChI | InChI=1S/C12H12N4O4/c1-20-10(18)7-16-6-8(5-14-16)15-12(19)11-9(17)3-2-4-13-11/h2-6,17H,7H2,1H3,(H,15,19) |
| InChIKey | GRTIGOVJPARXNN-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |