C13H14N4O4 — CID 61017726
methyl 2-[4-[(2-methoxypyridine-3-carbonyl)amino]pyrazol-1-yl]acetate (PubChem CID 61017726) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is methyl 2-[4-[(2-methoxypyridine-3-carbonyl)amino]pyrazol-1-yl]acetate.
| Compound Name | methyl 2-[4-[(2-methoxypyridine-3-carbonyl)amino]pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 61017726 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | methyl 2-[4-[(2-methoxypyridine-3-carbonyl)amino]pyrazol-1-yl]acetate |
| SMILES | COC(=O)Cn1cc(NC(=O)c2cccnc2OC)cn1 |
| InChI | InChI=1S/C13H14N4O4/c1-20-11(18)8-17-7-9(6-15-17)16-12(19)10-4-3-5-14-13(10)21-2/h3-7H,8H2,1-2H3,(H,16,19) |
| InChIKey | IHPASELTVWACKY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |