C12H13ClN4O2 — CID 61052437
2-chloro-N-[1-(2-methoxyethyl)pyrazol-4-yl]pyridine-3-carboxamide (PubChem CID 61052437) has the molecular formula C12H13ClN4O2 and a molecular weight of 280.71 g/mol. Its IUPAC name is 2-chloro-N-[1-(2-methoxyethyl)pyrazol-4-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[1-(2-methoxyethyl)pyrazol-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 61052437 |
| Molecular Formula | C12H13ClN4O2 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-chloro-N-[1-(2-methoxyethyl)pyrazol-4-yl]pyridine-3-carboxamide |
| SMILES | COCCn1cc(NC(=O)c2cccnc2Cl)cn1 |
| InChI | InChI=1S/C12H13ClN4O2/c1-19-6-5-17-8-9(7-15-17)16-12(18)10-3-2-4-14-11(10)13/h2-4,7-8H,5-6H2,1H3,(H,16,18) |
| InChIKey | IHLFUZPAJFDEDD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|