C13H15N5O3 — CID 107074249
4-amino-3-hydroxy-N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]benzamide (PubChem CID 107074249) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is 4-amino-3-hydroxy-N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]benzamide.
| Compound Name | 4-amino-3-hydroxy-N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 107074249 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 4-amino-3-hydroxy-N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]benzamide |
| SMILES | CNC(=O)Cn1cc(NC(=O)c2ccc(N)c(O)c2)cn1 |
| InChI | InChI=1S/C13H15N5O3/c1-15-12(20)7-18-6-9(5-16-18)17-13(21)8-2-3-10(14)11(19)4-8/h2-6,19H,7,14H2,1H3,(H,15,20)(H,17,21) |
| InChIKey | RSSIYRHPASUOGT-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|