C16H16N4O3 — CID 134703092
2-methyl-N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]-1-benzofuran-5-carboxamide (PubChem CID 134703092) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-methyl-N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]-1-benzofuran-5-carboxamide.
| Compound Name | 2-methyl-N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 134703092 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-methyl-N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]-1-benzofuran-5-carboxamide |
| SMILES | CNC(=O)Cn1cc(NC(=O)c2ccc3oc(C)cc3c2)cn1 |
| InChI | InChI=1S/C16H16N4O3/c1-10-5-12-6-11(3-4-14(12)23-10)16(22)19-13-7-18-20(8-13)9-15(21)17-2/h3-8H,9H2,1-2H3,(H,17,21)(H,19,22) |
| InChIKey | QOKIKMANIAGTRN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |